C30H37N3O4 — CID 11562449
3-[4-[6-[heptylcarbamoyl(methyl)amino]-2-pyridinyl]-3-phenylmethoxyphenyl]propanoic acid (PubChem CID 11562449) has the molecular formula C30H37N3O4 and a molecular weight of 503.64 g/mol. Its IUPAC name is 3-[4-[6-[heptylcarbamoyl(methyl)amino]-2-pyridinyl]-3-phenylmethoxyphenyl]propanoic acid.
| Compound Name | 3-[4-[6-[heptylcarbamoyl(methyl)amino]-2-pyridinyl]-3-phenylmethoxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 11562449 |
| Molecular Formula | C30H37N3O4 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | 3-[4-[6-[heptylcarbamoyl(methyl)amino]-2-pyridinyl]-3-phenylmethoxyphenyl]propanoic acid |
| SMILES | CCCCCCCNC(=O)N(C)c1cccc(-c2ccc(CCC(=O)O)cc2OCc2ccccc2)n1 |
| InChI | InChI=1S/C30H37N3O4/c1-3-4-5-6-10-20-31-30(36)33(2)28-15-11-14-26(32-28)25-18-16-23(17-19-29(34)35)21-27(25)37-22-24-12-8-7-9-13-24/h7-9,11-16,18,21H,3-6,10,17,19-20,22H2,1-2H3,(H,31,36)(H,34,35) |
| InChIKey | BVTWBGUGTATZCL-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|