C24H33N3O4 — CID 123507015
2-ethoxy-2-methyl-3-[4-[6-[methyl(pentylcarbamoyl)amino]-2-pyridinyl]phenyl]propanoic acid (PubChem CID 123507015) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is 2-ethoxy-2-methyl-3-[4-[6-[methyl(pentylcarbamoyl)amino]-2-pyridinyl]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-2-methyl-3-[4-[6-[methyl(pentylcarbamoyl)amino]-2-pyridinyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 123507015 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 2-ethoxy-2-methyl-3-[4-[6-[methyl(pentylcarbamoyl)amino]-2-pyridinyl]phenyl]propanoic acid |
| SMILES | CCCCCNC(=O)N(C)c1cccc(-c2ccc(CC(C)(OCC)C(=O)O)cc2)n1 |
| InChI | InChI=1S/C24H33N3O4/c1-5-7-8-16-25-23(30)27(4)21-11-9-10-20(26-21)19-14-12-18(13-15-19)17-24(3,22(28)29)31-6-2/h9-15H,5-8,16-17H2,1-4H3,(H,25,30)(H,28,29) |
| InChIKey | JFECWQAGWUPFDL-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|