C23H33N3O4S — CID 67148111
(2S)-2-ethoxy-3-[4-[2-[heptylcarbamoyl(methyl)amino]-1,3-thiazol-5-yl]phenyl]propanoic acid (PubChem CID 67148111) has the molecular formula C23H33N3O4S and a molecular weight of 447.60 g/mol. Its IUPAC name is (2S)-2-ethoxy-3-[4-[2-[heptylcarbamoyl(methyl)amino]-1,3-thiazol-5-yl]phenyl]propanoic acid.
| Compound Name | (2S)-2-ethoxy-3-[4-[2-[heptylcarbamoyl(methyl)amino]-1,3-thiazol-5-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 67148111 |
| Molecular Formula | C23H33N3O4S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | (2S)-2-ethoxy-3-[4-[2-[heptylcarbamoyl(methyl)amino]-1,3-thiazol-5-yl]phenyl]propanoic acid |
| SMILES | CCCCCCCNC(=O)N(C)c1ncc(-c2ccc(C[C@H](OCC)C(=O)O)cc2)s1 |
| InChI | InChI=1S/C23H33N3O4S/c1-4-6-7-8-9-14-24-22(29)26(3)23-25-16-20(31-23)18-12-10-17(11-13-18)15-19(21(27)28)30-5-2/h10-13,16,19H,4-9,14-15H2,1-3H3,(H,24,29)(H,27,28)/t19-/m0/s1 |
| InChIKey | RLURCSREVNHMLN-IBGZPJMESA-N |
| XLogP | 4.96 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|