C27H31N3O4 — CID 67148293
(2S)-2-ethoxy-3-[4-[6-[methyl(3-phenylpropylcarbamoyl)amino]-2-pyridinyl]phenyl]propanoic acid (PubChem CID 67148293) has the molecular formula C27H31N3O4 and a molecular weight of 461.56 g/mol. Its IUPAC name is (2S)-2-ethoxy-3-[4-[6-[methyl(3-phenylpropylcarbamoyl)amino]-2-pyridinyl]phenyl]propanoic acid.
| Compound Name | (2S)-2-ethoxy-3-[4-[6-[methyl(3-phenylpropylcarbamoyl)amino]-2-pyridinyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 67148293 |
| Molecular Formula | C27H31N3O4 |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.23 |
| IUPAC Name | (2S)-2-ethoxy-3-[4-[6-[methyl(3-phenylpropylcarbamoyl)amino]-2-pyridinyl]phenyl]propanoic acid |
| SMILES | CCO[C@@H](Cc1ccc(-c2cccc(N(C)C(=O)NCCCc3ccccc3)n2)cc1)C(=O)O |
| InChI | InChI=1S/C27H31N3O4/c1-3-34-24(26(31)32)19-21-14-16-22(17-15-21)23-12-7-13-25(29-23)30(2)27(33)28-18-8-11-20-9-5-4-6-10-20/h4-7,9-10,12-17,24H,3,8,11,18-19H2,1-2H3,(H,28,33)(H,31,32)/t24-/m0/s1 |
| InChIKey | PBBSFMIFLZNXMI-DEOSSOPVSA-N |
| XLogP | 4.56 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|