C23H35N5O4 — CID 67148187
(2S)-2-ethoxy-3-[4-[5-[heptylcarbamoyl(methyl)amino]-2-methyl-1,2,4-triazol-3-yl]phenyl]propanoic acid (PubChem CID 67148187) has the molecular formula C23H35N5O4 and a molecular weight of 445.56 g/mol. Its IUPAC name is (2S)-2-ethoxy-3-[4-[5-[heptylcarbamoyl(methyl)amino]-2-methyl-1,2,4-triazol-3-yl]phenyl]propanoic acid.
| Compound Name | (2S)-2-ethoxy-3-[4-[5-[heptylcarbamoyl(methyl)amino]-2-methyl-1,2,4-triazol-3-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 67148187 |
| Molecular Formula | C23H35N5O4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | (2S)-2-ethoxy-3-[4-[5-[heptylcarbamoyl(methyl)amino]-2-methyl-1,2,4-triazol-3-yl]phenyl]propanoic acid |
| SMILES | CCCCCCCNC(=O)N(C)c1nc(-c2ccc(C[C@H](OCC)C(=O)O)cc2)n(C)n1 |
| InChI | InChI=1S/C23H35N5O4/c1-5-7-8-9-10-15-24-23(31)27(3)22-25-20(28(4)26-22)18-13-11-17(12-14-18)16-19(21(29)30)32-6-2/h11-14,19H,5-10,15-16H2,1-4H3,(H,24,31)(H,29,30)/t19-/m0/s1 |
| InChIKey | OPNDUSQVMPCEMU-IBGZPJMESA-N |
| XLogP | 3.63 |
| TPSA | 109.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|