C32H46FN3O3 — CID 10347220
1-[3-[4-[2-ethoxy-3-(4-methylpiperidin-1-yl)-3-oxopropyl]phenyl]-4-fluorophenyl]-3-heptyl-1-methylurea (PubChem CID 10347220) has the molecular formula C32H46FN3O3 and a molecular weight of 539.74 g/mol. Its IUPAC name is 1-[3-[4-[2-ethoxy-3-(4-methylpiperidin-1-yl)-3-oxopropyl]phenyl]-4-fluorophenyl]-3-heptyl-1-methylurea.
| Compound Name | 1-[3-[4-[2-ethoxy-3-(4-methylpiperidin-1-yl)-3-oxopropyl]phenyl]-4-fluorophenyl]-3-heptyl-1-methylurea |
|---|---|
| PubChem CID | 10347220 |
| Molecular Formula | C32H46FN3O3 |
| Molecular Weight | 539.74 g/mol |
| Exact Mass | 539.35 |
| IUPAC Name | 1-[3-[4-[2-ethoxy-3-(4-methylpiperidin-1-yl)-3-oxopropyl]phenyl]-4-fluorophenyl]-3-heptyl-1-methylurea |
| SMILES | CCCCCCCNC(=O)N(C)c1ccc(F)c(-c2ccc(CC(OCC)C(=O)N3CCC(C)CC3)cc2)c1 |
| InChI | InChI=1S/C32H46FN3O3/c1-5-7-8-9-10-19-34-32(38)35(4)27-15-16-29(33)28(23-27)26-13-11-25(12-14-26)22-30(39-6-2)31(37)36-20-17-24(3)18-21-36/h11-16,23-24,30H,5-10,17-22H2,1-4H3,(H,34,38) |
| InChIKey | PBFDOPBGDOODII-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.74 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|