C33H47N3O3 — CID 10256573
1-[3-[4-[2-(cyclopropylmethoxy)-3-oxo-3-piperidin-1-ylpropyl]phenyl]phenyl]-3-heptyl-1-methylurea (PubChem CID 10256573) has the molecular formula C33H47N3O3 and a molecular weight of 533.76 g/mol. Its IUPAC name is 1-[3-[4-[2-(cyclopropylmethoxy)-3-oxo-3-piperidin-1-ylpropyl]phenyl]phenyl]-3-heptyl-1-methylurea.
| Compound Name | 1-[3-[4-[2-(cyclopropylmethoxy)-3-oxo-3-piperidin-1-ylpropyl]phenyl]phenyl]-3-heptyl-1-methylurea |
|---|---|
| PubChem CID | 10256573 |
| Molecular Formula | C33H47N3O3 |
| Molecular Weight | 533.76 g/mol |
| Exact Mass | 533.36 |
| IUPAC Name | 1-[3-[4-[2-(cyclopropylmethoxy)-3-oxo-3-piperidin-1-ylpropyl]phenyl]phenyl]-3-heptyl-1-methylurea |
| SMILES | CCCCCCCNC(=O)N(C)c1cccc(-c2ccc(CC(OCC3CC3)C(=O)N3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C33H47N3O3/c1-3-4-5-6-8-20-34-33(38)35(2)30-13-11-12-29(24-30)28-18-16-26(17-19-28)23-31(39-25-27-14-15-27)32(37)36-21-9-7-10-22-36/h11-13,16-19,24,27,31H,3-10,14-15,20-23,25H2,1-2H3,(H,34,38) |
| InChIKey | SNXKMPMZVUIBFM-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.76 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|