C28H38N2O4 — CID 69379370
(2S)-2-(cyclopropylmethoxy)-3-[2-[heptylcarbamoyl(methyl)amino]-4-phenylphenyl]propanoic acid (PubChem CID 69379370) has the molecular formula C28H38N2O4 and a molecular weight of 466.62 g/mol. Its IUPAC name is (2S)-2-(cyclopropylmethoxy)-3-[2-[heptylcarbamoyl(methyl)amino]-4-phenylphenyl]propanoic acid.
| Compound Name | (2S)-2-(cyclopropylmethoxy)-3-[2-[heptylcarbamoyl(methyl)amino]-4-phenylphenyl]propanoic acid |
|---|---|
| PubChem CID | 69379370 |
| Molecular Formula | C28H38N2O4 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | (2S)-2-(cyclopropylmethoxy)-3-[2-[heptylcarbamoyl(methyl)amino]-4-phenylphenyl]propanoic acid |
| SMILES | CCCCCCCNC(=O)N(C)c1cc(-c2ccccc2)ccc1C[C@H](OCC1CC1)C(=O)O |
| InChI | InChI=1S/C28H38N2O4/c1-3-4-5-6-10-17-29-28(33)30(2)25-18-23(22-11-8-7-9-12-22)15-16-24(25)19-26(27(31)32)34-20-21-13-14-21/h7-9,11-12,15-16,18,21,26H,3-6,10,13-14,17,19-20H2,1-2H3,(H,29,33)(H,31,32)/t26-/m0/s1 |
| InChIKey | VFUIBJUWIBNPBQ-SANMLTNESA-N |
| XLogP | 5.89 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|