C26H34N2O4 — CID 174480855
2-(butanoylamino)-3-[2-[hexanoyl(methyl)amino]-4-phenylphenyl]propanoic acid (PubChem CID 174480855) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is 2-(butanoylamino)-3-[2-[hexanoyl(methyl)amino]-4-phenylphenyl]propanoic acid.
| Compound Name | 2-(butanoylamino)-3-[2-[hexanoyl(methyl)amino]-4-phenylphenyl]propanoic acid |
|---|---|
| PubChem CID | 174480855 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 2-(butanoylamino)-3-[2-[hexanoyl(methyl)amino]-4-phenylphenyl]propanoic acid |
| SMILES | CCCCCC(=O)N(C)c1cc(-c2ccccc2)ccc1CC(NC(=O)CCC)C(=O)O |
| InChI | InChI=1S/C26H34N2O4/c1-4-6-8-14-25(30)28(3)23-18-20(19-12-9-7-10-13-19)15-16-21(23)17-22(26(31)32)27-24(29)11-5-2/h7,9-10,12-13,15-16,18,22H,4-6,8,11,14,17H2,1-3H3,(H,27,29)(H,31,32) |
| InChIKey | AZHQWSGZLKTODF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|