C30H36N2O4 — CID 10254940
3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]-2-phenoxypropanoic acid (PubChem CID 10254940) has the molecular formula C30H36N2O4 and a molecular weight of 488.63 g/mol. Its IUPAC name is 3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]-2-phenoxypropanoic acid.
| Compound Name | 3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]-2-phenoxypropanoic acid |
|---|---|
| PubChem CID | 10254940 |
| Molecular Formula | C30H36N2O4 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | 3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]-2-phenoxypropanoic acid |
| SMILES | CCCCCCCNC(=O)N(C)c1cccc(-c2ccc(CC(Oc3ccccc3)C(=O)O)cc2)c1 |
| InChI | InChI=1S/C30H36N2O4/c1-3-4-5-6-10-20-31-30(35)32(2)26-13-11-12-25(22-26)24-18-16-23(17-19-24)21-28(29(33)34)36-27-14-8-7-9-15-27/h7-9,11-19,22,28H,3-6,10,20-21H2,1-2H3,(H,31,35)(H,33,34) |
| InChIKey | AAVMIOBJBLRRQJ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|