C23H28N2O4 — CID 68959382
(E)-2-methoxy-3-[4-[3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]prop-2-enoic acid (PubChem CID 68959382) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is (E)-2-methoxy-3-[4-[3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-methoxy-3-[4-[3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68959382 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | (E)-2-methoxy-3-[4-[3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]prop-2-enoic acid |
| SMILES | CCCCCNC(=O)N(C)c1cccc(-c2ccc(/C=C(/OC)C(=O)O)cc2)c1 |
| InChI | InChI=1S/C23H28N2O4/c1-4-5-6-14-24-23(28)25(2)20-9-7-8-19(16-20)18-12-10-17(11-13-18)15-21(29-3)22(26)27/h7-13,15-16H,4-6,14H2,1-3H3,(H,24,28)(H,26,27)/b21-15+ |
| InChIKey | UQXPYDMYLSMUTQ-RCCKNPSSSA-N |
| XLogP | 4.76 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|