C30H42N2O4 — CID 91431150
2-[[3-butoxy-4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]methylidene]butanoic acid (PubChem CID 91431150) has the molecular formula C30H42N2O4 and a molecular weight of 494.68 g/mol. Its IUPAC name is 2-[[3-butoxy-4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]methylidene]butanoic acid.
| Compound Name | 2-[[3-butoxy-4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]methylidene]butanoic acid |
|---|---|
| PubChem CID | 91431150 |
| Molecular Formula | C30H42N2O4 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | 2-[[3-butoxy-4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]methylidene]butanoic acid |
| SMILES | CCCCCCCNC(=O)N(C)c1cccc(-c2ccc(C=C(CC)C(=O)O)cc2OCCCC)c1 |
| InChI | InChI=1S/C30H42N2O4/c1-5-8-10-11-12-18-31-30(35)32(4)26-15-13-14-25(22-26)27-17-16-23(20-24(7-3)29(33)34)21-28(27)36-19-9-6-2/h13-17,20-22H,5-12,18-19H2,1-4H3,(H,31,35)(H,33,34) |
| InChIKey | QUIMPVOHISCXKW-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|