C23H30N2O4 — CID 91334936
3-[3-methoxy-4-[3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]propanoic acid (PubChem CID 91334936) has the molecular formula C23H30N2O4 and a molecular weight of 398.50 g/mol. Its IUPAC name is 3-[3-methoxy-4-[3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]propanoic acid.
| Compound Name | 3-[3-methoxy-4-[3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 91334936 |
| Molecular Formula | C23H30N2O4 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.22 |
| IUPAC Name | 3-[3-methoxy-4-[3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]propanoic acid |
| SMILES | CCCCCNC(=O)N(C)c1cccc(-c2ccc(CCC(=O)O)cc2OC)c1 |
| InChI | InChI=1S/C23H30N2O4/c1-4-5-6-14-24-23(28)25(2)19-9-7-8-18(16-19)20-12-10-17(11-13-22(26)27)15-21(20)29-3/h7-10,12,15-16H,4-6,11,13-14H2,1-3H3,(H,24,28)(H,26,27) |
| InChIKey | DADDZYKHYRVJAK-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|