C30H33F3N2O5 — CID 69114201
3-[4-[3-[2-(3-methoxyphenyl)ethylcarbamoyl-methylamino]phenyl]-3-(4,4,4-trifluorobutoxy)phenyl]propanoic acid (PubChem CID 69114201) has the molecular formula C30H33F3N2O5 and a molecular weight of 558.60 g/mol. Its IUPAC name is 3-[4-[3-[2-(3-methoxyphenyl)ethylcarbamoyl-methylamino]phenyl]-3-(4,4,4-trifluorobutoxy)phenyl]propanoic acid.
| Compound Name | 3-[4-[3-[2-(3-methoxyphenyl)ethylcarbamoyl-methylamino]phenyl]-3-(4,4,4-trifluorobutoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 69114201 |
| Molecular Formula | C30H33F3N2O5 |
| Molecular Weight | 558.60 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | 3-[4-[3-[2-(3-methoxyphenyl)ethylcarbamoyl-methylamino]phenyl]-3-(4,4,4-trifluorobutoxy)phenyl]propanoic acid |
| SMILES | COc1cccc(CCNC(=O)N(C)c2cccc(-c3ccc(CCC(=O)O)cc3OCCCC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C30H33F3N2O5/c1-35(29(38)34-16-14-21-6-3-9-25(18-21)39-2)24-8-4-7-23(20-24)26-12-10-22(11-13-28(36)37)19-27(26)40-17-5-15-30(31,32)33/h3-4,6-10,12,18-20H,5,11,13-17H2,1-2H3,(H,34,38)(H,36,37) |
| InChIKey | FNAFYYGAGAKAFT-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.60 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|