C30H32F3N2O5- — CID 154062028
3-[4-[3-[2-(3-methoxyphenyl)ethylcarbamoyl-methylamino]phenyl]-3-(4,4,4-trifluorobutoxy)phenyl]propanoate (PubChem CID 154062028) has the molecular formula C30H32F3N2O5- and a molecular weight of 557.59 g/mol. Its IUPAC name is 3-[4-[3-[2-(3-methoxyphenyl)ethylcarbamoyl-methylamino]phenyl]-3-(4,4,4-trifluorobutoxy)phenyl]propanoate.
| Compound Name | 3-[4-[3-[2-(3-methoxyphenyl)ethylcarbamoyl-methylamino]phenyl]-3-(4,4,4-trifluorobutoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 154062028 |
| Molecular Formula | C30H32F3N2O5- |
| Molecular Weight | 557.59 g/mol |
| Exact Mass | 557.23 |
| IUPAC Name | 3-[4-[3-[2-(3-methoxyphenyl)ethylcarbamoyl-methylamino]phenyl]-3-(4,4,4-trifluorobutoxy)phenyl]propanoate |
| SMILES | COc1cccc(CCNC(=O)N(C)c2cccc(-c3ccc(CCC(=O)[O-])cc3OCCCC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C30H33F3N2O5/c1-35(29(38)34-16-14-21-6-3-9-25(18-21)39-2)24-8-4-7-23(20-24)26-12-10-22(11-13-28(36)37)19-27(26)40-17-5-15-30(31,32)33/h3-4,6-10,12,18-20H,5,11,13-17H2,1-2H3,(H,34,38)(H,36,37)/p-1 |
| InChIKey | FNAFYYGAGAKAFT-UHFFFAOYSA-M |
| XLogP | 5.15 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.59 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|