C28H40N2O5 — CID 67272094
methyl 3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]-3-(3-hydroxypropoxy)phenyl]propanoate (PubChem CID 67272094) has the molecular formula C28H40N2O5 and a molecular weight of 484.64 g/mol. Its IUPAC name is methyl 3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]-3-(3-hydroxypropoxy)phenyl]propanoate.
| Compound Name | methyl 3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]-3-(3-hydroxypropoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 67272094 |
| Molecular Formula | C28H40N2O5 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | methyl 3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]-3-(3-hydroxypropoxy)phenyl]propanoate |
| SMILES | CCCCCCCNC(=O)N(C)c1cccc(-c2ccc(CCC(=O)OC)cc2OCCCO)c1 |
| InChI | InChI=1S/C28H40N2O5/c1-4-5-6-7-8-17-29-28(33)30(2)24-12-9-11-23(21-24)25-15-13-22(14-16-27(32)34-3)20-26(25)35-19-10-18-31/h9,11-13,15,20-21,31H,4-8,10,14,16-19H2,1-3H3,(H,29,33) |
| InChIKey | XNSXQYKEXXUDRB-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|