C30H44N2O4 — CID 91348367
methyl 3-[3-[3-[heptylcarbamoyl(methyl)amino]phenyl]-2-pentoxyphenyl]propanoate (PubChem CID 91348367) has the molecular formula C30H44N2O4 and a molecular weight of 496.69 g/mol. Its IUPAC name is methyl 3-[3-[3-[heptylcarbamoyl(methyl)amino]phenyl]-2-pentoxyphenyl]propanoate.
| Compound Name | methyl 3-[3-[3-[heptylcarbamoyl(methyl)amino]phenyl]-2-pentoxyphenyl]propanoate |
|---|---|
| PubChem CID | 91348367 |
| Molecular Formula | C30H44N2O4 |
| Molecular Weight | 496.69 g/mol |
| Exact Mass | 496.33 |
| IUPAC Name | methyl 3-[3-[3-[heptylcarbamoyl(methyl)amino]phenyl]-2-pentoxyphenyl]propanoate |
| SMILES | CCCCCCCNC(=O)N(C)c1cccc(-c2cccc(CCC(=O)OC)c2OCCCCC)c1 |
| InChI | InChI=1S/C30H44N2O4/c1-5-7-9-10-11-21-31-30(34)32(3)26-17-13-16-25(23-26)27-18-14-15-24(19-20-28(33)35-4)29(27)36-22-12-8-6-2/h13-18,23H,5-12,19-22H2,1-4H3,(H,31,34) |
| InChIKey | LWSSMIXOXASWMB-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.69 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|