C15H25BN2O3 — CID 11558369
[3-[heptylcarbamoyl(methyl)amino]phenyl]boronic acid (PubChem CID 11558369) has the molecular formula C15H25BN2O3 and a molecular weight of 292.19 g/mol. Its IUPAC name is [3-[heptylcarbamoyl(methyl)amino]phenyl]boronic acid.
| Compound Name | [3-[heptylcarbamoyl(methyl)amino]phenyl]boronic acid |
|---|---|
| PubChem CID | 11558369 |
| Molecular Formula | C15H25BN2O3 |
| Molecular Weight | 292.19 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | [3-[heptylcarbamoyl(methyl)amino]phenyl]boronic acid |
| SMILES | CCCCCCCNC(=O)N(C)c1cccc(B(O)O)c1 |
| InChI | InChI=1S/C15H25BN2O3/c1-3-4-5-6-7-11-17-15(19)18(2)14-10-8-9-13(12-14)16(20)21/h8-10,12,20-21H,3-7,11H2,1-2H3,(H,17,19) |
| InChIKey | PIIAVDUOUINDAN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.19 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|