C11H16N2O2 — CID 107734166
1-(3-hydroxyphenyl)-1-methyl-3-propylurea (PubChem CID 107734166) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 1-(3-hydroxyphenyl)-1-methyl-3-propylurea.
| Compound Name | 1-(3-hydroxyphenyl)-1-methyl-3-propylurea |
|---|---|
| PubChem CID | 107734166 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 1-(3-hydroxyphenyl)-1-methyl-3-propylurea |
| SMILES | CCCNC(=O)N(C)c1cccc(O)c1 |
| InChI | InChI=1S/C11H16N2O2/c1-3-7-12-11(15)13(2)9-5-4-6-10(14)8-9/h4-6,8,14H,3,7H2,1-2H3,(H,12,15) |
| InChIKey | HPVDKVVKGIURDH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |