C12H19BN2O3 — CID 11673237
[3-[butylcarbamoyl(methyl)amino]phenyl]boronic acid (PubChem CID 11673237) has the molecular formula C12H19BN2O3 and a molecular weight of 250.11 g/mol. Its IUPAC name is [3-[butylcarbamoyl(methyl)amino]phenyl]boronic acid.
| Compound Name | [3-[butylcarbamoyl(methyl)amino]phenyl]boronic acid |
|---|---|
| PubChem CID | 11673237 |
| Molecular Formula | C12H19BN2O3 |
| Molecular Weight | 250.11 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | [3-[butylcarbamoyl(methyl)amino]phenyl]boronic acid |
| SMILES | CCCCNC(=O)N(C)c1cccc(B(O)O)c1 |
| InChI | InChI=1S/C12H19BN2O3/c1-3-4-8-14-12(16)15(2)11-7-5-6-10(9-11)13(17)18/h5-7,9,17-18H,3-4,8H2,1-2H3,(H,14,16) |
| InChIKey | RBQXDMZHXSTPQA-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.11 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|