C18H26BN3O8 — CID 177246823
(2S)-6-(3-borono-N-methylanilino)-2-(3-carboxypropylcarbamoylamino)-6-oxohexanoic acid (PubChem CID 177246823) has the molecular formula C18H26BN3O8 and a molecular weight of 423.23 g/mol. Its IUPAC name is (2S)-6-(3-borono-N-methylanilino)-2-(3-carboxypropylcarbamoylamino)-6-oxohexanoic acid.
| Compound Name | (2S)-6-(3-borono-N-methylanilino)-2-(3-carboxypropylcarbamoylamino)-6-oxohexanoic acid |
|---|---|
| PubChem CID | 177246823 |
| Molecular Formula | C18H26BN3O8 |
| Molecular Weight | 423.23 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | (2S)-6-(3-borono-N-methylanilino)-2-(3-carboxypropylcarbamoylamino)-6-oxohexanoic acid |
| SMILES | CN(C(=O)CCC[C@H](NC(=O)NCCCC(=O)O)C(=O)O)c1cccc(B(O)O)c1 |
| InChI | InChI=1S/C18H26BN3O8/c1-22(13-6-2-5-12(11-13)19(29)30)15(23)8-3-7-14(17(26)27)21-18(28)20-10-4-9-16(24)25/h2,5-6,11,14,29-30H,3-4,7-10H2,1H3,(H,24,25)(H,26,27)(H2,20,21,28)/t14-/m0/s1 |
| InChIKey | KSPHMTGEYNFXOL-AWEZNQCLSA-N |
| XLogP | -0.88 |
| TPSA | 176.50 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.23 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|