C13H23N3O5 — CID 107838733
(2R)-2-[3-(cyclopropylamino)propylcarbamoylamino]hexanedioic acid (PubChem CID 107838733) has the molecular formula C13H23N3O5 and a molecular weight of 301.34 g/mol. Its IUPAC name is (2R)-2-[3-(cyclopropylamino)propylcarbamoylamino]hexanedioic acid.
| Compound Name | (2R)-2-[3-(cyclopropylamino)propylcarbamoylamino]hexanedioic acid |
|---|---|
| PubChem CID | 107838733 |
| Molecular Formula | C13H23N3O5 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.16 |
| IUPAC Name | (2R)-2-[3-(cyclopropylamino)propylcarbamoylamino]hexanedioic acid |
| SMILES | O=C(O)CCC[C@@H](NC(=O)NCCCNC1CC1)C(=O)O |
| InChI | InChI=1S/C13H23N3O5/c17-11(18)4-1-3-10(12(19)20)16-13(21)15-8-2-7-14-9-5-6-9/h9-10,14H,1-8H2,(H,17,18)(H,19,20)(H2,15,16,21)/t10-/m1/s1 |
| InChIKey | RDFLHRFPJYLESA-SNVBAGLBSA-N |
| XLogP | 0.14 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|