C12H23N3O3 — CID 61408013
(2S)-2-[3-(cyclopropylamino)propylcarbamoylamino]-3-methylbutanoic acid (PubChem CID 61408013) has the molecular formula C12H23N3O3 and a molecular weight of 257.33 g/mol. Its IUPAC name is (2S)-2-[3-(cyclopropylamino)propylcarbamoylamino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[3-(cyclopropylamino)propylcarbamoylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 61408013 |
| Molecular Formula | C12H23N3O3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | (2S)-2-[3-(cyclopropylamino)propylcarbamoylamino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)NCCCNC1CC1)C(=O)O |
| InChI | InChI=1S/C12H23N3O3/c1-8(2)10(11(16)17)15-12(18)14-7-3-6-13-9-4-5-9/h8-10,13H,3-7H2,1-2H3,(H,16,17)(H2,14,15,18)/t10-/m0/s1 |
| InChIKey | GQJQAWKTOLRCFU-JTQLQIEISA-N |
| XLogP | 0.54 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|