C14H22N2O5 — CID 107839000
(2R)-2-(dicyclopropylmethylcarbamoylamino)hexanedioic acid (PubChem CID 107839000) has the molecular formula C14H22N2O5 and a molecular weight of 298.34 g/mol. Its IUPAC name is (2R)-2-(dicyclopropylmethylcarbamoylamino)hexanedioic acid.
| Compound Name | (2R)-2-(dicyclopropylmethylcarbamoylamino)hexanedioic acid |
|---|---|
| PubChem CID | 107839000 |
| Molecular Formula | C14H22N2O5 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | (2R)-2-(dicyclopropylmethylcarbamoylamino)hexanedioic acid |
| SMILES | O=C(O)CCC[C@@H](NC(=O)NC(C1CC1)C1CC1)C(=O)O |
| InChI | InChI=1S/C14H22N2O5/c17-11(18)3-1-2-10(13(19)20)15-14(21)16-12(8-4-5-8)9-6-7-9/h8-10,12H,1-7H2,(H,17,18)(H,19,20)(H2,15,16,21)/t10-/m1/s1 |
| InChIKey | GUGSHYRNOYFCMF-SNVBAGLBSA-N |
| XLogP | 1.18 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |