C12H18N2O5 — CID 106222858
(2R)-2-(pent-4-ynylcarbamoylamino)hexanedioic acid (PubChem CID 106222858) has the molecular formula C12H18N2O5 and a molecular weight of 270.28 g/mol. Its IUPAC name is (2R)-2-(pent-4-ynylcarbamoylamino)hexanedioic acid.
| Compound Name | (2R)-2-(pent-4-ynylcarbamoylamino)hexanedioic acid |
|---|---|
| PubChem CID | 106222858 |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | (2R)-2-(pent-4-ynylcarbamoylamino)hexanedioic acid |
| SMILES | C#CCCCNC(=O)N[C@H](CCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H18N2O5/c1-2-3-4-8-13-12(19)14-9(11(17)18)6-5-7-10(15)16/h1,9H,3-8H2,(H,15,16)(H,17,18)(H2,13,14,19)/t9-/m1/s1 |
| InChIKey | IZWYELKLOXYTTB-SECBINFHSA-N |
| XLogP | 0.41 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|