C12H16N4O3 — CID 114160258
(2R)-3-(1H-imidazol-5-yl)-2-(pent-4-ynylcarbamoylamino)propanoic acid (PubChem CID 114160258) has the molecular formula C12H16N4O3 and a molecular weight of 264.28 g/mol. Its IUPAC name is (2R)-3-(1H-imidazol-5-yl)-2-(pent-4-ynylcarbamoylamino)propanoic acid.
| Compound Name | (2R)-3-(1H-imidazol-5-yl)-2-(pent-4-ynylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 114160258 |
| Molecular Formula | C12H16N4O3 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (2R)-3-(1H-imidazol-5-yl)-2-(pent-4-ynylcarbamoylamino)propanoic acid |
| SMILES | C#CCCCNC(=O)N[C@H](Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C12H16N4O3/c1-2-3-4-5-14-12(19)16-10(11(17)18)6-9-7-13-8-15-9/h1,7-8,10H,3-6H2,(H,13,15)(H,17,18)(H2,14,16,19)/t10-/m1/s1 |
| InChIKey | KAMNLBLURYTVOY-SNVBAGLBSA-N |
| XLogP | 0.12 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|