C10H17N5O5S — CID 104895018
(2R)-3-(1H-imidazol-5-yl)-2-[2-(methanesulfonamido)ethylcarbamoylamino]propanoic acid (PubChem CID 104895018) has the molecular formula C10H17N5O5S and a molecular weight of 319.34 g/mol. Its IUPAC name is (2R)-3-(1H-imidazol-5-yl)-2-[2-(methanesulfonamido)ethylcarbamoylamino]propanoic acid.
| Compound Name | (2R)-3-(1H-imidazol-5-yl)-2-[2-(methanesulfonamido)ethylcarbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 104895018 |
| Molecular Formula | C10H17N5O5S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | (2R)-3-(1H-imidazol-5-yl)-2-[2-(methanesulfonamido)ethylcarbamoylamino]propanoic acid |
| SMILES | CS(=O)(=O)NCCNC(=O)N[C@H](Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C10H17N5O5S/c1-21(19,20)14-3-2-12-10(18)15-8(9(16)17)4-7-5-11-6-13-7/h5-6,8,14H,2-4H2,1H3,(H,11,13)(H,16,17)(H2,12,15,18)/t8-/m1/s1 |
| InChIKey | HNKBLNXKMOXMFP-MRVPVSSYSA-N |
| XLogP | -1.75 |
| TPSA | 153.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|