C13H20N4O4 — CID 107864272
3-(1H-imidazol-5-yl)-2-[2-(2-methylprop-2-enoxy)ethylcarbamoylamino]propanoic acid (PubChem CID 107864272) has the molecular formula C13H20N4O4 and a molecular weight of 296.33 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)-2-[2-(2-methylprop-2-enoxy)ethylcarbamoylamino]propanoic acid.
| Compound Name | 3-(1H-imidazol-5-yl)-2-[2-(2-methylprop-2-enoxy)ethylcarbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 107864272 |
| Molecular Formula | C13H20N4O4 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 3-(1H-imidazol-5-yl)-2-[2-(2-methylprop-2-enoxy)ethylcarbamoylamino]propanoic acid |
| SMILES | C=C(C)COCCNC(=O)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C13H20N4O4/c1-9(2)7-21-4-3-15-13(20)17-11(12(18)19)5-10-6-14-8-16-10/h6,8,11H,1,3-5,7H2,2H3,(H,14,16)(H,18,19)(H2,15,17,20) |
| InChIKey | HZBPLTRILJNEOU-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 116.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|