C12H18N4O3 — CID 106191581
(2R)-3-(1H-imidazol-5-yl)-2-(3-methylbut-2-enylcarbamoylamino)propanoic acid (PubChem CID 106191581) has the molecular formula C12H18N4O3 and a molecular weight of 266.30 g/mol. Its IUPAC name is (2R)-3-(1H-imidazol-5-yl)-2-(3-methylbut-2-enylcarbamoylamino)propanoic acid.
| Compound Name | (2R)-3-(1H-imidazol-5-yl)-2-(3-methylbut-2-enylcarbamoylamino)propanoic acid |
|---|---|
| PubChem CID | 106191581 |
| Molecular Formula | C12H18N4O3 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | (2R)-3-(1H-imidazol-5-yl)-2-(3-methylbut-2-enylcarbamoylamino)propanoic acid |
| SMILES | CC(C)=CCNC(=O)N[C@H](Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C12H18N4O3/c1-8(2)3-4-14-12(19)16-10(11(17)18)5-9-6-13-7-15-9/h3,6-7,10H,4-5H2,1-2H3,(H,13,15)(H,17,18)(H2,14,16,19)/t10-/m1/s1 |
| InChIKey | VVPZUNIQPJSYQE-SNVBAGLBSA-N |
| XLogP | 0.67 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|