C10H13F3N4O3S — CID 106431450
3-(1H-imidazol-5-yl)-2-[2-(trifluoromethylsulfanyl)ethylcarbamoylamino]propanoic acid (PubChem CID 106431450) has the molecular formula C10H13F3N4O3S and a molecular weight of 326.30 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)-2-[2-(trifluoromethylsulfanyl)ethylcarbamoylamino]propanoic acid.
| Compound Name | 3-(1H-imidazol-5-yl)-2-[2-(trifluoromethylsulfanyl)ethylcarbamoylamino]propanoic acid |
|---|---|
| PubChem CID | 106431450 |
| Molecular Formula | C10H13F3N4O3S |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 3-(1H-imidazol-5-yl)-2-[2-(trifluoromethylsulfanyl)ethylcarbamoylamino]propanoic acid |
| SMILES | O=C(NCCSC(F)(F)F)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C10H13F3N4O3S/c11-10(12,13)21-2-1-15-9(20)17-7(8(18)19)3-6-4-14-5-16-6/h4-5,7H,1-3H2,(H,14,16)(H,18,19)(H2,15,17,20) |
| InChIKey | UYEMFMJVKWZGSQ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|