C11H18N2O4 — CID 106216120
2-(hex-5-ynylcarbamoylamino)-4-hydroxybutanoic acid (PubChem CID 106216120) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is 2-(hex-5-ynylcarbamoylamino)-4-hydroxybutanoic acid.
| Compound Name | 2-(hex-5-ynylcarbamoylamino)-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 106216120 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 2-(hex-5-ynylcarbamoylamino)-4-hydroxybutanoic acid |
| SMILES | C#CCCCCNC(=O)NC(CCO)C(=O)O |
| InChI | InChI=1S/C11H18N2O4/c1-2-3-4-5-7-12-11(17)13-9(6-8-14)10(15)16/h1,9,14H,3-8H2,(H,15,16)(H2,12,13,17) |
| InChIKey | BWNCOYKSVXASDO-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|