C10H16N2O4 — CID 116644911
4-hydroxy-2-(pent-3-ynylcarbamoylamino)butanoic acid (PubChem CID 116644911) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is 4-hydroxy-2-(pent-3-ynylcarbamoylamino)butanoic acid.
| Compound Name | 4-hydroxy-2-(pent-3-ynylcarbamoylamino)butanoic acid |
|---|---|
| PubChem CID | 116644911 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 4-hydroxy-2-(pent-3-ynylcarbamoylamino)butanoic acid |
| SMILES | CC#CCCNC(=O)NC(CCO)C(=O)O |
| InChI | InChI=1S/C10H16N2O4/c1-2-3-4-6-11-10(16)12-8(5-7-13)9(14)15/h8,13H,4-7H2,1H3,(H,14,15)(H2,11,12,16) |
| InChIKey | DKJMXZVOYUTLKZ-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|