C22H26BFN4O10 — CID 177246775
(2S)-2-[[(1S)-5-[(6-borono-4-fluoroquinolin-2-yl)-methylamino]-1-carboxy-5-oxopentyl]carbamoylamino]pentanedioic acid (PubChem CID 177246775) has the molecular formula C22H26BFN4O10 and a molecular weight of 536.28 g/mol. Its IUPAC name is (2S)-2-[[(1S)-5-[(6-borono-4-fluoroquinolin-2-yl)-methylamino]-1-carboxy-5-oxopentyl]carbamoylamino]pentanedioic acid.
| Compound Name | (2S)-2-[[(1S)-5-[(6-borono-4-fluoroquinolin-2-yl)-methylamino]-1-carboxy-5-oxopentyl]carbamoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 177246775 |
| Molecular Formula | C22H26BFN4O10 |
| Molecular Weight | 536.28 g/mol |
| Exact Mass | 536.17 |
| IUPAC Name | (2S)-2-[[(1S)-5-[(6-borono-4-fluoroquinolin-2-yl)-methylamino]-1-carboxy-5-oxopentyl]carbamoylamino]pentanedioic acid |
| SMILES | CN(C(=O)CCC[C@H](NC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O)c1cc(F)c2cc(B(O)O)ccc2n1 |
| InChI | InChI=1S/C22H26BFN4O10/c1-28(17-10-13(24)12-9-11(23(37)38)5-6-14(12)25-17)18(29)4-2-3-15(20(32)33)26-22(36)27-16(21(34)35)7-8-19(30)31/h5-6,9-10,15-16,37-38H,2-4,7-8H2,1H3,(H,30,31)(H,32,33)(H,34,35)(H2,26,27,36)/t15-,16-/m0/s1 |
| InChIKey | LRJRIVCYUATGDH-HOTGVXAUSA-N |
| XLogP | -0.74 |
| TPSA | 226.69 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.28 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|