C17H24BFN4O8 — CID 177246829
6-[(5-borono-4-fluoro-2-pyridinyl)-methylamino]-2-(3-carboxypropylcarbamoylamino)-6-oxohexanoic acid (PubChem CID 177246829) has the molecular formula C17H24BFN4O8 and a molecular weight of 442.21 g/mol. Its IUPAC name is 6-[(5-borono-4-fluoro-2-pyridinyl)-methylamino]-2-(3-carboxypropylcarbamoylamino)-6-oxohexanoic acid.
| Compound Name | 6-[(5-borono-4-fluoro-2-pyridinyl)-methylamino]-2-(3-carboxypropylcarbamoylamino)-6-oxohexanoic acid |
|---|---|
| PubChem CID | 177246829 |
| Molecular Formula | C17H24BFN4O8 |
| Molecular Weight | 442.21 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 6-[(5-borono-4-fluoro-2-pyridinyl)-methylamino]-2-(3-carboxypropylcarbamoylamino)-6-oxohexanoic acid |
| SMILES | CN(C(=O)CCCC(NC(=O)NCCCC(=O)O)C(=O)O)c1cc(F)c(B(O)O)cn1 |
| InChI | InChI=1S/C17H24BFN4O8/c1-23(13-8-11(19)10(9-21-13)18(30)31)14(24)5-2-4-12(16(27)28)22-17(29)20-7-3-6-15(25)26/h8-9,12,30-31H,2-7H2,1H3,(H,25,26)(H,27,28)(H2,20,22,29) |
| InChIKey | JBWXPIAGRFIVJR-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 189.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.21 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|