C27H36N2O4 — CID 91429920
methyl 2-ethoxy-3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]prop-2-enoate (PubChem CID 91429920) has the molecular formula C27H36N2O4 and a molecular weight of 452.60 g/mol. Its IUPAC name is methyl 2-ethoxy-3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]prop-2-enoate.
| Compound Name | methyl 2-ethoxy-3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 91429920 |
| Molecular Formula | C27H36N2O4 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.27 |
| IUPAC Name | methyl 2-ethoxy-3-[4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]prop-2-enoate |
| SMILES | CCCCCCCNC(=O)N(C)c1cccc(-c2ccc(C=C(OCC)C(=O)OC)cc2)c1 |
| InChI | InChI=1S/C27H36N2O4/c1-5-7-8-9-10-18-28-27(31)29(3)24-13-11-12-23(20-24)22-16-14-21(15-17-22)19-25(33-6-2)26(30)32-4/h11-17,19-20H,5-10,18H2,1-4H3,(H,28,31) |
| InChIKey | TZVINKLHVBALGA-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|