C25H32N2O4 — CID 68961394
(E)-2-ethoxy-3-[4-[3-[hexylcarbamoyl(methyl)amino]phenyl]phenyl]prop-2-enoic acid (PubChem CID 68961394) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is (E)-2-ethoxy-3-[4-[3-[hexylcarbamoyl(methyl)amino]phenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-ethoxy-3-[4-[3-[hexylcarbamoyl(methyl)amino]phenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68961394 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | (E)-2-ethoxy-3-[4-[3-[hexylcarbamoyl(methyl)amino]phenyl]phenyl]prop-2-enoic acid |
| SMILES | CCCCCCNC(=O)N(C)c1cccc(-c2ccc(/C=C(/OCC)C(=O)O)cc2)c1 |
| InChI | InChI=1S/C25H32N2O4/c1-4-6-7-8-16-26-25(30)27(3)22-11-9-10-21(18-22)20-14-12-19(13-15-20)17-23(24(28)29)31-5-2/h9-15,17-18H,4-8,16H2,1-3H3,(H,26,30)(H,28,29)/b23-17+ |
| InChIKey | BRZHKBRQICOVKP-HAVVHWLPSA-N |
| XLogP | 5.54 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|