C28H38N2O6 — CID 91480686
3-[3-(2-ethoxyethoxy)-4-[3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]-2-methoxybut-2-enoic acid (PubChem CID 91480686) has the molecular formula C28H38N2O6 and a molecular weight of 498.62 g/mol. Its IUPAC name is 3-[3-(2-ethoxyethoxy)-4-[3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]-2-methoxybut-2-enoic acid.
| Compound Name | 3-[3-(2-ethoxyethoxy)-4-[3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]-2-methoxybut-2-enoic acid |
|---|---|
| PubChem CID | 91480686 |
| Molecular Formula | C28H38N2O6 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 3-[3-(2-ethoxyethoxy)-4-[3-[methyl(pentylcarbamoyl)amino]phenyl]phenyl]-2-methoxybut-2-enoic acid |
| SMILES | CCCCCNC(=O)N(C)c1cccc(-c2ccc(C(C)=C(OC)C(=O)O)cc2OCCOCC)c1 |
| InChI | InChI=1S/C28H38N2O6/c1-6-8-9-15-29-28(33)30(4)23-12-10-11-22(18-23)24-14-13-21(20(3)26(34-5)27(31)32)19-25(24)36-17-16-35-7-2/h10-14,18-19H,6-9,15-17H2,1-5H3,(H,29,33)(H,31,32) |
| InChIKey | XZRGOHBDMDKIIG-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|