C31H47N3O4 — CID 67272954
methyl 3-[3-[2-(diethylamino)ethoxy]-4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]propanoate (PubChem CID 67272954) has the molecular formula C31H47N3O4 and a molecular weight of 525.73 g/mol. Its IUPAC name is methyl 3-[3-[2-(diethylamino)ethoxy]-4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]propanoate.
| Compound Name | methyl 3-[3-[2-(diethylamino)ethoxy]-4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]propanoate |
|---|---|
| PubChem CID | 67272954 |
| Molecular Formula | C31H47N3O4 |
| Molecular Weight | 525.73 g/mol |
| Exact Mass | 525.36 |
| IUPAC Name | methyl 3-[3-[2-(diethylamino)ethoxy]-4-[3-[heptylcarbamoyl(methyl)amino]phenyl]phenyl]propanoate |
| SMILES | CCCCCCCNC(=O)N(C)c1cccc(-c2ccc(CCC(=O)OC)cc2OCCN(CC)CC)c1 |
| InChI | InChI=1S/C31H47N3O4/c1-6-9-10-11-12-20-32-31(36)33(4)27-15-13-14-26(24-27)28-18-16-25(17-19-30(35)37-5)23-29(28)38-22-21-34(7-2)8-3/h13-16,18,23-24H,6-12,17,19-22H2,1-5H3,(H,32,36) |
| InChIKey | KYWATFNUKONQMG-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.73 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|