C28H38N2O4 — CID 68965764
(Z)-3-[3-butoxy-4-[3-(heptylcarbamoylamino)phenyl]phenyl]-2-methylprop-2-enoic acid (PubChem CID 68965764) has the molecular formula C28H38N2O4 and a molecular weight of 466.62 g/mol. Its IUPAC name is (Z)-3-[3-butoxy-4-[3-(heptylcarbamoylamino)phenyl]phenyl]-2-methylprop-2-enoic acid.
| Compound Name | (Z)-3-[3-butoxy-4-[3-(heptylcarbamoylamino)phenyl]phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 68965764 |
| Molecular Formula | C28H38N2O4 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | (Z)-3-[3-butoxy-4-[3-(heptylcarbamoylamino)phenyl]phenyl]-2-methylprop-2-enoic acid |
| SMILES | CCCCCCCNC(=O)Nc1cccc(-c2ccc(/C=C(/C)C(=O)O)cc2OCCCC)c1 |
| InChI | InChI=1S/C28H38N2O4/c1-4-6-8-9-10-16-29-28(33)30-24-13-11-12-23(20-24)25-15-14-22(18-21(3)27(31)32)19-26(25)34-17-7-5-2/h11-15,18-20H,4-10,16-17H2,1-3H3,(H,31,32)(H2,29,30,33)/b21-18- |
| InChIKey | RLLQEJHYYYNQRR-UZYVYHOESA-N |
| XLogP | 7.11 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|