C20H23NO4 — CID 69017206
(Z)-3-[4-(3-aminophenyl)-3-butoxyphenyl]-2-methoxyprop-2-enoic acid (PubChem CID 69017206) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is (Z)-3-[4-(3-aminophenyl)-3-butoxyphenyl]-2-methoxyprop-2-enoic acid.
| Compound Name | (Z)-3-[4-(3-aminophenyl)-3-butoxyphenyl]-2-methoxyprop-2-enoic acid |
|---|---|
| PubChem CID | 69017206 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | (Z)-3-[4-(3-aminophenyl)-3-butoxyphenyl]-2-methoxyprop-2-enoic acid |
| SMILES | CCCCOc1cc(/C=C(\OC)C(=O)O)ccc1-c1cccc(N)c1 |
| InChI | InChI=1S/C20H23NO4/c1-3-4-10-25-18-11-14(12-19(24-2)20(22)23)8-9-17(18)15-6-5-7-16(21)13-15/h5-9,11-13H,3-4,10,21H2,1-2H3,(H,22,23)/b19-12- |
| InChIKey | JRKAGTJMIQYDRG-UNOMPAQXSA-N |
| XLogP | 4.19 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|