C27H35NO5 — CID 69112685
3-[3-butoxy-4-[3-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]phenyl]phenyl]-2-methylprop-2-enoic acid (PubChem CID 69112685) has the molecular formula C27H35NO5 and a molecular weight of 453.58 g/mol. Its IUPAC name is 3-[3-butoxy-4-[3-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]phenyl]phenyl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[3-butoxy-4-[3-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]phenyl]phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 69112685 |
| Molecular Formula | C27H35NO5 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | 3-[3-butoxy-4-[3-[[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]methyl]phenyl]phenyl]-2-methylprop-2-enoic acid |
| SMILES | CCCCOc1cc(C=C(C)C(=O)O)ccc1-c1cccc(CN(C)C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C27H35NO5/c1-7-8-14-32-24-17-20(15-19(2)25(29)30)12-13-23(24)22-11-9-10-21(16-22)18-28(6)26(31)33-27(3,4)5/h9-13,15-17H,7-8,14,18H2,1-6H3,(H,29,30) |
| InChIKey | HUPXIHZGSLLHOG-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|