C21H25NO3 — CID 91244259
tert-butyl N-[[3-(4-formyl-3-methylphenyl)phenyl]methyl]-N-methylcarbamate (PubChem CID 91244259) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is tert-butyl N-[[3-(4-formyl-3-methylphenyl)phenyl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[3-(4-formyl-3-methylphenyl)phenyl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 91244259 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | tert-butyl N-[[3-(4-formyl-3-methylphenyl)phenyl]methyl]-N-methylcarbamate |
| SMILES | Cc1cc(-c2cccc(CN(C)C(=O)OC(C)(C)C)c2)ccc1C=O |
| InChI | InChI=1S/C21H25NO3/c1-15-11-18(9-10-19(15)14-23)17-8-6-7-16(12-17)13-22(5)20(24)25-21(2,3)4/h6-12,14H,13H2,1-5H3 |
| InChIKey | UGTHYAOMQQCEJB-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|