C27H29N3O4 — CID 55647395
tert-butyl N-[[3-[(4-benzamidobenzoyl)amino]phenyl]methyl]-N-methylcarbamate (PubChem CID 55647395) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is tert-butyl N-[[3-[(4-benzamidobenzoyl)amino]phenyl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[3-[(4-benzamidobenzoyl)amino]phenyl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 55647395 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | tert-butyl N-[[3-[(4-benzamidobenzoyl)amino]phenyl]methyl]-N-methylcarbamate |
| SMILES | CN(Cc1cccc(NC(=O)c2ccc(NC(=O)c3ccccc3)cc2)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H29N3O4/c1-27(2,3)34-26(33)30(4)18-19-9-8-12-23(17-19)29-25(32)21-13-15-22(16-14-21)28-24(31)20-10-6-5-7-11-20/h5-17H,18H2,1-4H3,(H,28,31)(H,29,32) |
| InChIKey | WVWJZJMHNNBPNB-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |