C18H22BrN3O3 — CID 55850427
tert-butyl N-[[3-[(4-bromo-1H-pyrrole-2-carbonyl)amino]phenyl]methyl]-N-methylcarbamate (PubChem CID 55850427) has the molecular formula C18H22BrN3O3 and a molecular weight of 408.30 g/mol. Its IUPAC name is tert-butyl N-[[3-[(4-bromo-1H-pyrrole-2-carbonyl)amino]phenyl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[3-[(4-bromo-1H-pyrrole-2-carbonyl)amino]phenyl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 55850427 |
| Molecular Formula | C18H22BrN3O3 |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 407.08 |
| IUPAC Name | tert-butyl N-[[3-[(4-bromo-1H-pyrrole-2-carbonyl)amino]phenyl]methyl]-N-methylcarbamate |
| SMILES | CN(Cc1cccc(NC(=O)c2cc(Br)c[nH]2)c1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H22BrN3O3/c1-18(2,3)25-17(24)22(4)11-12-6-5-7-14(8-12)21-16(23)15-9-13(19)10-20-15/h5-10,20H,11H2,1-4H3,(H,21,23) |
| InChIKey | ATJDPNRYOASEOU-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |