C13H13BrN2O3S — CID 51128969
4-bromo-N-[3-(methylsulfonylmethyl)phenyl]-1H-pyrrole-2-carboxamide (PubChem CID 51128969) has the molecular formula C13H13BrN2O3S and a molecular weight of 357.23 g/mol. Its IUPAC name is 4-bromo-N-[3-(methylsulfonylmethyl)phenyl]-1H-pyrrole-2-carboxamide.
| Compound Name | 4-bromo-N-[3-(methylsulfonylmethyl)phenyl]-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 51128969 |
| Molecular Formula | C13H13BrN2O3S |
| Molecular Weight | 357.23 g/mol |
| Exact Mass | 355.98 |
| IUPAC Name | 4-bromo-N-[3-(methylsulfonylmethyl)phenyl]-1H-pyrrole-2-carboxamide |
| SMILES | CS(=O)(=O)Cc1cccc(NC(=O)c2cc(Br)c[nH]2)c1 |
| InChI | InChI=1S/C13H13BrN2O3S/c1-20(18,19)8-9-3-2-4-11(5-9)16-13(17)12-6-10(14)7-15-12/h2-7,15H,8H2,1H3,(H,16,17) |
| InChIKey | CGWZEBSXWJUTEJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.23 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |