C24H33N3O5S — CID 55647421
tert-butyl N-[[3-[[3-(diethylsulfamoyl)benzoyl]amino]phenyl]methyl]-N-methylcarbamate (PubChem CID 55647421) has the molecular formula C24H33N3O5S and a molecular weight of 475.61 g/mol. Its IUPAC name is tert-butyl N-[[3-[[3-(diethylsulfamoyl)benzoyl]amino]phenyl]methyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[[3-[[3-(diethylsulfamoyl)benzoyl]amino]phenyl]methyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 55647421 |
| Molecular Formula | C24H33N3O5S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | tert-butyl N-[[3-[[3-(diethylsulfamoyl)benzoyl]amino]phenyl]methyl]-N-methylcarbamate |
| SMILES | CCN(CC)S(=O)(=O)c1cccc(C(=O)Nc2cccc(CN(C)C(=O)OC(C)(C)C)c2)c1 |
| InChI | InChI=1S/C24H33N3O5S/c1-7-27(8-2)33(30,31)21-14-10-12-19(16-21)22(28)25-20-13-9-11-18(15-20)17-26(6)23(29)32-24(3,4)5/h9-16H,7-8,17H2,1-6H3,(H,25,28) |
| InChIKey | SNGNMQKHOIAYHT-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |