C28H26F3NO5 — CID 68958154
(E)-2-ethoxy-3-[3-methoxy-4-[3-[[methyl-[4-(trifluoromethyl)benzoyl]amino]methyl]phenyl]phenyl]prop-2-enoic acid (PubChem CID 68958154) has the molecular formula C28H26F3NO5 and a molecular weight of 513.51 g/mol. Its IUPAC name is (E)-2-ethoxy-3-[3-methoxy-4-[3-[[methyl-[4-(trifluoromethyl)benzoyl]amino]methyl]phenyl]phenyl]prop-2-enoic acid.
| Compound Name | (E)-2-ethoxy-3-[3-methoxy-4-[3-[[methyl-[4-(trifluoromethyl)benzoyl]amino]methyl]phenyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68958154 |
| Molecular Formula | C28H26F3NO5 |
| Molecular Weight | 513.51 g/mol |
| Exact Mass | 513.18 |
| IUPAC Name | (E)-2-ethoxy-3-[3-methoxy-4-[3-[[methyl-[4-(trifluoromethyl)benzoyl]amino]methyl]phenyl]phenyl]prop-2-enoic acid |
| SMILES | CCO/C(=C/c1ccc(-c2cccc(CN(C)C(=O)c3ccc(C(F)(F)F)cc3)c2)c(OC)c1)C(=O)O |
| InChI | InChI=1S/C28H26F3NO5/c1-4-37-25(27(34)35)16-18-8-13-23(24(15-18)36-3)21-7-5-6-19(14-21)17-32(2)26(33)20-9-11-22(12-10-20)28(29,30)31/h5-16H,4,17H2,1-3H3,(H,34,35)/b25-16+ |
| InChIKey | IOFIPCCKXQRCNB-PCLIKHOPSA-N |
| XLogP | 6.12 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.51 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|