3-[[(3,4-dimethoxybenzoyl)-methylamino]methyl]benzoic acid

C18H19NO5 — CID 59190884

IUPAC3-[[(3,4-dimethoxybenzoyl)-methylamino]methyl]benzoic acid
SMILESCOc1ccc(C(=O)N(C)Cc2cccc(C(=O)O)c2)cc1OC
InChIInChI=1S/C18H19NO5/c1-19(11-12-5-4-6-14(9-12)18(21)22)17(20)13-7-8-15(23-2)16(10-13)24-3/h4-10H,11H2,1-3H3,(H,21,22)
InChIKeyDMWCFYGMHBNWGZ-UHFFFAOYSA-N
MW329.35 g/mol
LogP2.67
Rot. Bonds6

About 3-[[(3,4-dimethoxybenzoyl)-methylamino]methyl]benzoic acid

3-[[(3,4-dimethoxybenzoyl)-methylamino]methyl]benzoic acid (PubChem CID 59190884) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is 3-[[(3,4-dimethoxybenzoyl)-methylamino]methyl]benzoic acid.

Molecular Properties

Compound Name3-[[(3,4-dimethoxybenzoyl)-methylamino]methyl]benzoic acid
PubChem CID59190884
Molecular FormulaC18H19NO5
Molecular Weight329.35 g/mol
Exact Mass329.13
IUPAC Name3-[[(3,4-dimethoxybenzoyl)-methylamino]methyl]benzoic acid
SMILESCOc1ccc(C(=O)N(C)Cc2cccc(C(=O)O)c2)cc1OC
InChIInChI=1S/C18H19NO5/c1-19(11-12-5-4-6-14(9-12)18(21)22)17(20)13-7-8-15(23-2)16(10-13)24-3/h4-10H,11H2,1-3H3,(H,21,22)
InChIKeyDMWCFYGMHBNWGZ-UHFFFAOYSA-N
XLogP2.67
TPSA76.07 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500329.35
LogP ≤ 52.67
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-[[(3,4-dimethoxybenzoyl)-methylamino]methyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[[(3,4-dimethoxybenzoyl)-methylamino]methyl]benzoic acid?
The IUPAC name of 3-[[(3,4-dimethoxybenzoyl)-methylamino]methyl]benzoic acid (CID 59190884) is 3-[[(3,4-dimethoxybenzoyl)-methylamino]methyl]benzoic acid.
What is the SMILES notation for 3-[[(3,4-dimethoxybenzoyl)-methylamino]methyl]benzoic acid?
The canonical SMILES for 3-[[(3,4-dimethoxybenzoyl)-methylamino]methyl]benzoic acid is COc1ccc(C(=O)N(C)Cc2cccc(C(=O)O)c2)cc1OC.
What is the InChIKey of 3-[[(3,4-dimethoxybenzoyl)-methylamino]methyl]benzoic acid?
The InChIKey is DMWCFYGMHBNWGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO5/c1-19(11-12-5-4-6-14(9-12)18(21)22)17(20)13-7-8-15(23-2)16(10-13)24-3/h4-10H,11H2,1-3H3,(H,21,22).
What are the key properties of 3-[[(3,4-dimethoxybenzoyl)-methylamino]methyl]benzoic acid?
3-[[(3,4-dimethoxybenzoyl)-methylamino]methyl]benzoic acid has a molecular weight of 329.35 g/mol, XLogP of 2.67, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(3,4-dimethoxybenzoyl)-methylamino]methyl]benzoic acid is sourced from PubChem (CID 59190884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).