C32H31NO4 — CID 91035288
(2S)-2-ethoxy-3-[2-[3-[[methyl-(4-phenylbenzoyl)amino]methyl]phenyl]phenyl]propanoic acid (PubChem CID 91035288) has the molecular formula C32H31NO4 and a molecular weight of 493.60 g/mol. Its IUPAC name is (2S)-2-ethoxy-3-[2-[3-[[methyl-(4-phenylbenzoyl)amino]methyl]phenyl]phenyl]propanoic acid.
| Compound Name | (2S)-2-ethoxy-3-[2-[3-[[methyl-(4-phenylbenzoyl)amino]methyl]phenyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 91035288 |
| Molecular Formula | C32H31NO4 |
| Molecular Weight | 493.60 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | (2S)-2-ethoxy-3-[2-[3-[[methyl-(4-phenylbenzoyl)amino]methyl]phenyl]phenyl]propanoic acid |
| SMILES | CCO[C@@H](Cc1ccccc1-c1cccc(CN(C)C(=O)c2ccc(-c3ccccc3)cc2)c1)C(=O)O |
| InChI | InChI=1S/C32H31NO4/c1-3-37-30(32(35)36)21-28-13-7-8-15-29(28)27-14-9-10-23(20-27)22-33(2)31(34)26-18-16-25(17-19-26)24-11-5-4-6-12-24/h4-20,30H,3,21-22H2,1-2H3,(H,35,36)/t30-/m0/s1 |
| InChIKey | YNCWPMUAOPXZJC-PMERELPUSA-N |
| XLogP | 6.32 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.60 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |