C42H46N2O6 — CID 10009709
N-[[3-[4-[3-[benzyl(methyl)amino]-2-ethoxy-3-oxopropyl]phenyl]phenyl]methyl]-6-(2-methoxyethoxymethoxy)-N-methylnaphthalene-2-carboxamide (PubChem CID 10009709) has the molecular formula C42H46N2O6 and a molecular weight of 674.84 g/mol. Its IUPAC name is N-[[3-[4-[3-[benzyl(methyl)amino]-2-ethoxy-3-oxopropyl]phenyl]phenyl]methyl]-6-(2-methoxyethoxymethoxy)-N-methylnaphthalene-2-carboxamide.
| Compound Name | N-[[3-[4-[3-[benzyl(methyl)amino]-2-ethoxy-3-oxopropyl]phenyl]phenyl]methyl]-6-(2-methoxyethoxymethoxy)-N-methylnaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 10009709 |
| Molecular Formula | C42H46N2O6 |
| Molecular Weight | 674.84 g/mol |
| Exact Mass | 674.34 |
| IUPAC Name | N-[[3-[4-[3-[benzyl(methyl)amino]-2-ethoxy-3-oxopropyl]phenyl]phenyl]methyl]-6-(2-methoxyethoxymethoxy)-N-methylnaphthalene-2-carboxamide |
| SMILES | CCOC(Cc1ccc(-c2cccc(CN(C)C(=O)c3ccc4cc(OCOCCOC)ccc4c3)c2)cc1)C(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C42H46N2O6/c1-5-49-40(42(46)44(3)28-32-10-7-6-8-11-32)25-31-14-16-34(17-15-31)35-13-9-12-33(24-35)29-43(2)41(45)38-19-18-37-27-39(21-20-36(37)26-38)50-30-48-23-22-47-4/h6-21,24,26-27,40H,5,22-23,25,28-30H2,1-4H3 |
| InChIKey | VMUHOAAZKBXXMI-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.84 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|